C17H26N4O3 — CID 95549432
6-[4-(hydroxymethyl)-4-[[(2R)-oxan-2-yl]methyl]piperidin-1-yl]pyrazine-2-carboxamide (PubChem CID 95549432) has the molecular formula C17H26N4O3 and a molecular weight of 334.42 g/mol. Its IUPAC name is 6-[4-(hydroxymethyl)-4-[[(2R)-oxan-2-yl]methyl]piperidin-1-yl]pyrazine-2-carboxamide.
| Compound Name | 6-[4-(hydroxymethyl)-4-[[(2R)-oxan-2-yl]methyl]piperidin-1-yl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 95549432 |
| Molecular Formula | C17H26N4O3 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.20 |
| IUPAC Name | 6-[4-(hydroxymethyl)-4-[[(2R)-oxan-2-yl]methyl]piperidin-1-yl]pyrazine-2-carboxamide |
| SMILES | NC(=O)c1cncc(N2CCC(CO)(C[C@H]3CCCCO3)CC2)n1 |
| InChI | InChI=1S/C17H26N4O3/c18-16(23)14-10-19-11-15(20-14)21-6-4-17(12-22,5-7-21)9-13-3-1-2-8-24-13/h10-11,13,22H,1-9,12H2,(H2,18,23)/t13-/m1/s1 |
| InChIKey | NOTRINJURGOUBP-CYBMUJFWSA-N |
| XLogP | 1.11 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |