C19H27N5O2 — CID 56752872
[4-(oxan-2-ylmethyl)-1-(1-phenyltetrazol-5-yl)piperidin-4-yl]methanol (PubChem CID 56752872) has the molecular formula C19H27N5O2 and a molecular weight of 357.46 g/mol. Its IUPAC name is [4-(oxan-2-ylmethyl)-1-(1-phenyltetrazol-5-yl)piperidin-4-yl]methanol.
| Compound Name | [4-(oxan-2-ylmethyl)-1-(1-phenyltetrazol-5-yl)piperidin-4-yl]methanol |
|---|---|
| PubChem CID | 56752872 |
| Molecular Formula | C19H27N5O2 |
| Molecular Weight | 357.46 g/mol |
| Exact Mass | 357.22 |
| IUPAC Name | [4-(oxan-2-ylmethyl)-1-(1-phenyltetrazol-5-yl)piperidin-4-yl]methanol |
| SMILES | OCC1(CC2CCCCO2)CCN(c2nnnn2-c2ccccc2)CC1 |
| InChI | InChI=1S/C19H27N5O2/c25-15-19(14-17-8-4-5-13-26-17)9-11-23(12-10-19)18-20-21-22-24(18)16-6-2-1-3-7-16/h1-3,6-7,17,25H,4-5,8-15H2 |
| InChIKey | VLATVEWJKOTTJG-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 76.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.46 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |