C17H20ClN3O3 — CID 66822305
[(1S)-1-[8-chloro-2-[[(2S)-oxolan-2-yl]methylamino]quinolin-3-yl]ethyl]carbamic acid (PubChem CID 66822305) has the molecular formula C17H20ClN3O3 and a molecular weight of 349.82 g/mol. Its IUPAC name is [(1S)-1-[8-chloro-2-[[(2S)-oxolan-2-yl]methylamino]quinolin-3-yl]ethyl]carbamic acid.
| Compound Name | [(1S)-1-[8-chloro-2-[[(2S)-oxolan-2-yl]methylamino]quinolin-3-yl]ethyl]carbamic acid |
|---|---|
| PubChem CID | 66822305 |
| Molecular Formula | C17H20ClN3O3 |
| Molecular Weight | 349.82 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | [(1S)-1-[8-chloro-2-[[(2S)-oxolan-2-yl]methylamino]quinolin-3-yl]ethyl]carbamic acid |
| SMILES | C[C@H](NC(=O)O)c1cc2cccc(Cl)c2nc1NC[C@@H]1CCCO1 |
| InChI | InChI=1S/C17H20ClN3O3/c1-10(20-17(22)23)13-8-11-4-2-6-14(18)15(11)21-16(13)19-9-12-5-3-7-24-12/h2,4,6,8,10,12,20H,3,5,7,9H2,1H3,(H,19,21)(H,22,23)/t10-,12-/m0/s1 |
| InChIKey | VBKCHOXZAUAPNY-JQWIXIFHSA-N |
| XLogP | 3.81 |
| TPSA | 83.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.82 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |