C19H26ClN3O3 — CID 140578708
tert-butyl N-[(1S)-1-[8-chloro-2-(2-methoxyethylamino)quinolin-3-yl]ethyl]carbamate (PubChem CID 140578708) has the molecular formula C19H26ClN3O3 and a molecular weight of 379.89 g/mol. Its IUPAC name is tert-butyl N-[(1S)-1-[8-chloro-2-(2-methoxyethylamino)quinolin-3-yl]ethyl]carbamate.
| Compound Name | tert-butyl N-[(1S)-1-[8-chloro-2-(2-methoxyethylamino)quinolin-3-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 140578708 |
| Molecular Formula | C19H26ClN3O3 |
| Molecular Weight | 379.89 g/mol |
| Exact Mass | 379.17 |
| IUPAC Name | tert-butyl N-[(1S)-1-[8-chloro-2-(2-methoxyethylamino)quinolin-3-yl]ethyl]carbamate |
| SMILES | COCCNc1nc2c(Cl)cccc2cc1[C@H](C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H26ClN3O3/c1-12(22-18(24)26-19(2,3)4)14-11-13-7-6-8-15(20)16(13)23-17(14)21-9-10-25-5/h6-8,11-12H,9-10H2,1-5H3,(H,21,23)(H,22,24)/t12-/m0/s1 |
| InChIKey | LIXSTSWOYXONIY-LBPRGKRZSA-N |
| XLogP | 4.53 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.89 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|