C21H29N3O2S — CID 140576921
tert-butyl N-[(1S)-1-(8-methyl-2-thiomorpholin-4-ylquinolin-3-yl)ethyl]carbamate (PubChem CID 140576921) has the molecular formula C21H29N3O2S and a molecular weight of 387.55 g/mol. Its IUPAC name is tert-butyl N-[(1S)-1-(8-methyl-2-thiomorpholin-4-ylquinolin-3-yl)ethyl]carbamate.
| Compound Name | tert-butyl N-[(1S)-1-(8-methyl-2-thiomorpholin-4-ylquinolin-3-yl)ethyl]carbamate |
|---|---|
| PubChem CID | 140576921 |
| Molecular Formula | C21H29N3O2S |
| Molecular Weight | 387.55 g/mol |
| Exact Mass | 387.20 |
| IUPAC Name | tert-butyl N-[(1S)-1-(8-methyl-2-thiomorpholin-4-ylquinolin-3-yl)ethyl]carbamate |
| SMILES | Cc1cccc2cc([C@H](C)NC(=O)OC(C)(C)C)c(N3CCSCC3)nc12 |
| InChI | InChI=1S/C21H29N3O2S/c1-14-7-6-8-16-13-17(15(2)22-20(25)26-21(3,4)5)19(23-18(14)16)24-9-11-27-12-10-24/h6-8,13,15H,9-12H2,1-5H3,(H,22,25)/t15-/m0/s1 |
| InChIKey | KZTIUWKUTGBIDZ-HNNXBMFYSA-N |
| XLogP | 4.68 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.55 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |