C20H26ClN3O3 — CID 123560504
tert-butyl N-[1-[8-chloro-2-(3-hydroxypyrrolidin-1-yl)quinolin-3-yl]ethyl]carbamate (PubChem CID 123560504) has the molecular formula C20H26ClN3O3 and a molecular weight of 391.90 g/mol. Its IUPAC name is tert-butyl N-[1-[8-chloro-2-(3-hydroxypyrrolidin-1-yl)quinolin-3-yl]ethyl]carbamate.
| Compound Name | tert-butyl N-[1-[8-chloro-2-(3-hydroxypyrrolidin-1-yl)quinolin-3-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 123560504 |
| Molecular Formula | C20H26ClN3O3 |
| Molecular Weight | 391.90 g/mol |
| Exact Mass | 391.17 |
| IUPAC Name | tert-butyl N-[1-[8-chloro-2-(3-hydroxypyrrolidin-1-yl)quinolin-3-yl]ethyl]carbamate |
| SMILES | CC(NC(=O)OC(C)(C)C)c1cc2cccc(Cl)c2nc1N1CCC(O)C1 |
| InChI | InChI=1S/C20H26ClN3O3/c1-12(22-19(26)27-20(2,3)4)15-10-13-6-5-7-16(21)17(13)23-18(15)24-9-8-14(25)11-24/h5-7,10,12,14,25H,8-9,11H2,1-4H3,(H,22,26) |
| InChIKey | PBLVUQMFDKHESN-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 74.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.90 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |