C22H25ClN4O2 — CID 123948903
tert-butyl N-[(1S)-1-[8-chloro-2-(pyridin-2-ylmethylamino)quinolin-3-yl]ethyl]carbamate (PubChem CID 123948903) has the molecular formula C22H25ClN4O2 and a molecular weight of 412.92 g/mol. Its IUPAC name is tert-butyl N-[(1S)-1-[8-chloro-2-(pyridin-2-ylmethylamino)quinolin-3-yl]ethyl]carbamate.
| Compound Name | tert-butyl N-[(1S)-1-[8-chloro-2-(pyridin-2-ylmethylamino)quinolin-3-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 123948903 |
| Molecular Formula | C22H25ClN4O2 |
| Molecular Weight | 412.92 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | tert-butyl N-[(1S)-1-[8-chloro-2-(pyridin-2-ylmethylamino)quinolin-3-yl]ethyl]carbamate |
| SMILES | C[C@H](NC(=O)OC(C)(C)C)c1cc2cccc(Cl)c2nc1NCc1ccccn1 |
| InChI | InChI=1S/C22H25ClN4O2/c1-14(26-21(28)29-22(2,3)4)17-12-15-8-7-10-18(23)19(15)27-20(17)25-13-16-9-5-6-11-24-16/h5-12,14H,13H2,1-4H3,(H,25,27)(H,26,28)/t14-/m0/s1 |
| InChIKey | MQGGYZVBXLFKPH-AWEZNQCLSA-N |
| XLogP | 5.48 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.92 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |