C21H26ClNO4 — CID 156699423
tert-butyl N-[1-[2-(2-chlorophenyl)-4-(methoxymethoxy)phenyl]ethyl]carbamate (PubChem CID 156699423) has the molecular formula C21H26ClNO4 and a molecular weight of 391.90 g/mol. Its IUPAC name is tert-butyl N-[1-[2-(2-chlorophenyl)-4-(methoxymethoxy)phenyl]ethyl]carbamate.
| Compound Name | tert-butyl N-[1-[2-(2-chlorophenyl)-4-(methoxymethoxy)phenyl]ethyl]carbamate |
|---|---|
| PubChem CID | 156699423 |
| Molecular Formula | C21H26ClNO4 |
| Molecular Weight | 391.90 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | tert-butyl N-[1-[2-(2-chlorophenyl)-4-(methoxymethoxy)phenyl]ethyl]carbamate |
| SMILES | COCOc1ccc(C(C)NC(=O)OC(C)(C)C)c(-c2ccccc2Cl)c1 |
| InChI | InChI=1S/C21H26ClNO4/c1-14(23-20(24)27-21(2,3)4)16-11-10-15(26-13-25-5)12-18(16)17-8-6-7-9-19(17)22/h6-12,14H,13H2,1-5H3,(H,23,24) |
| InChIKey | DETUTCBNIHAAIX-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.90 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|