C17H21ClN2O2 — CID 87146008
tert-butyl N-[(1S)-1-(2-chloro-8-methylquinolin-3-yl)ethyl]carbamate (PubChem CID 87146008) has the molecular formula C17H21ClN2O2 and a molecular weight of 320.82 g/mol. Its IUPAC name is tert-butyl N-[(1S)-1-(2-chloro-8-methylquinolin-3-yl)ethyl]carbamate.
| Compound Name | tert-butyl N-[(1S)-1-(2-chloro-8-methylquinolin-3-yl)ethyl]carbamate |
|---|---|
| PubChem CID | 87146008 |
| Molecular Formula | C17H21ClN2O2 |
| Molecular Weight | 320.82 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | tert-butyl N-[(1S)-1-(2-chloro-8-methylquinolin-3-yl)ethyl]carbamate |
| SMILES | Cc1cccc2cc([C@H](C)NC(=O)OC(C)(C)C)c(Cl)nc12 |
| InChI | InChI=1S/C17H21ClN2O2/c1-10-7-6-8-12-9-13(15(18)20-14(10)12)11(2)19-16(21)22-17(3,4)5/h6-9,11H,1-5H3,(H,19,21)/t11-/m0/s1 |
| InChIKey | RXIOSWNXVHSGOL-NSHDSACASA-N |
| XLogP | 4.78 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.82 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|