C17H20ClFN2O2 — CID 140576941
tert-butyl N-[(1S)-1-(2-chloro-5-fluoro-8-methylquinolin-3-yl)ethyl]carbamate (PubChem CID 140576941) has the molecular formula C17H20ClFN2O2 and a molecular weight of 338.81 g/mol. Its IUPAC name is tert-butyl N-[(1S)-1-(2-chloro-5-fluoro-8-methylquinolin-3-yl)ethyl]carbamate.
| Compound Name | tert-butyl N-[(1S)-1-(2-chloro-5-fluoro-8-methylquinolin-3-yl)ethyl]carbamate |
|---|---|
| PubChem CID | 140576941 |
| Molecular Formula | C17H20ClFN2O2 |
| Molecular Weight | 338.81 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | tert-butyl N-[(1S)-1-(2-chloro-5-fluoro-8-methylquinolin-3-yl)ethyl]carbamate |
| SMILES | Cc1ccc(F)c2cc([C@H](C)NC(=O)OC(C)(C)C)c(Cl)nc12 |
| InChI | InChI=1S/C17H20ClFN2O2/c1-9-6-7-13(19)12-8-11(15(18)21-14(9)12)10(2)20-16(22)23-17(3,4)5/h6-8,10H,1-5H3,(H,20,22)/t10-/m0/s1 |
| InChIKey | HLTYUPYCERJEKN-JTQLQIEISA-N |
| XLogP | 4.92 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.81 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|