C21H23N5O2 — CID 56868361
(4-phenoxyphenyl)-[1-[2-(2H-tetrazol-5-yl)ethyl]piperidin-3-yl]methanone (PubChem CID 56868361) has the molecular formula C21H23N5O2 and a molecular weight of 377.45 g/mol. Its IUPAC name is (4-phenoxyphenyl)-[1-[2-(2H-tetrazol-5-yl)ethyl]piperidin-3-yl]methanone.
| Compound Name | (4-phenoxyphenyl)-[1-[2-(2H-tetrazol-5-yl)ethyl]piperidin-3-yl]methanone |
|---|---|
| PubChem CID | 56868361 |
| Molecular Formula | C21H23N5O2 |
| Molecular Weight | 377.45 g/mol |
| Exact Mass | 377.19 |
| IUPAC Name | (4-phenoxyphenyl)-[1-[2-(2H-tetrazol-5-yl)ethyl]piperidin-3-yl]methanone |
| SMILES | O=C(c1ccc(Oc2ccccc2)cc1)C1CCCN(CCc2nn[nH]n2)C1 |
| InChI | InChI=1S/C21H23N5O2/c27-21(16-8-10-19(11-9-16)28-18-6-2-1-3-7-18)17-5-4-13-26(15-17)14-12-20-22-24-25-23-20/h1-3,6-11,17H,4-5,12-15H2,(H,22,23,24,25) |
| InChIKey | BTNANUHWPVMISU-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 84.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.45 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |