C13H12F3N3O — CID 56869841
2-(6-methoxy-3-pyridinyl)-4-(3,3,3-trifluoropropyl)pyrimidine (PubChem CID 56869841) has the molecular formula C13H12F3N3O and a molecular weight of 283.25 g/mol. Its IUPAC name is 2-(6-methoxy-3-pyridinyl)-4-(3,3,3-trifluoropropyl)pyrimidine.
| Compound Name | 2-(6-methoxy-3-pyridinyl)-4-(3,3,3-trifluoropropyl)pyrimidine |
|---|---|
| PubChem CID | 56869841 |
| Molecular Formula | C13H12F3N3O |
| Molecular Weight | 283.25 g/mol |
| Exact Mass | 283.09 |
| IUPAC Name | 2-(6-methoxy-3-pyridinyl)-4-(3,3,3-trifluoropropyl)pyrimidine |
| SMILES | COc1ccc(-c2nccc(CCC(F)(F)F)n2)cn1 |
| InChI | InChI=1S/C13H12F3N3O/c1-20-11-3-2-9(8-18-11)12-17-7-5-10(19-12)4-6-13(14,15)16/h2-3,5,7-8H,4,6H2,1H3 |
| InChIKey | QCKVZLCUFQXCPS-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 47.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.25 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |