C19H25N3O2S — CID 56871259
2-[[benzylsulfamoyl(cyclohexyl)amino]methyl]pyridine (PubChem CID 56871259) has the molecular formula C19H25N3O2S and a molecular weight of 359.49 g/mol. Its IUPAC name is 2-[[benzylsulfamoyl(cyclohexyl)amino]methyl]pyridine.
| Compound Name | 2-[[benzylsulfamoyl(cyclohexyl)amino]methyl]pyridine |
|---|---|
| PubChem CID | 56871259 |
| Molecular Formula | C19H25N3O2S |
| Molecular Weight | 359.49 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | 2-[[benzylsulfamoyl(cyclohexyl)amino]methyl]pyridine |
| SMILES | O=S(=O)(NCc1ccccc1)N(Cc1ccccn1)C1CCCCC1 |
| InChI | InChI=1S/C19H25N3O2S/c23-25(24,21-15-17-9-3-1-4-10-17)22(19-12-5-2-6-13-19)16-18-11-7-8-14-20-18/h1,3-4,7-11,14,19,21H,2,5-6,12-13,15-16H2 |
| InChIKey | XKOVMKQBERKBOM-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.49 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |