C14H14ClN3O2S — CID 61042552
2-chloro-N-cyclopropyl-N-(pyridin-2-ylmethyl)pyridine-4-sulfonamide (PubChem CID 61042552) has the molecular formula C14H14ClN3O2S and a molecular weight of 323.81 g/mol. Its IUPAC name is 2-chloro-N-cyclopropyl-N-(pyridin-2-ylmethyl)pyridine-4-sulfonamide.
| Compound Name | 2-chloro-N-cyclopropyl-N-(pyridin-2-ylmethyl)pyridine-4-sulfonamide |
|---|---|
| PubChem CID | 61042552 |
| Molecular Formula | C14H14ClN3O2S |
| Molecular Weight | 323.81 g/mol |
| Exact Mass | 323.05 |
| IUPAC Name | 2-chloro-N-cyclopropyl-N-(pyridin-2-ylmethyl)pyridine-4-sulfonamide |
| SMILES | O=S(=O)(c1ccnc(Cl)c1)N(Cc1ccccn1)C1CC1 |
| InChI | InChI=1S/C14H14ClN3O2S/c15-14-9-13(6-8-17-14)21(19,20)18(12-4-5-12)10-11-3-1-2-7-16-11/h1-3,6-9,12H,4-5,10H2 |
| InChIKey | SDQKPQWAECPFLA-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 63.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.81 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|