C16H23N3O — CID 56871766
2-(2-ethylimidazol-1-yl)-1-[(2R,6R)-6-methyl-2-prop-2-enyl-3,6-dihydro-2H-pyridin-1-yl]ethanone (PubChem CID 56871766) has the molecular formula C16H23N3O and a molecular weight of 273.38 g/mol. Its IUPAC name is 2-(2-ethylimidazol-1-yl)-1-[(2R,6R)-6-methyl-2-prop-2-enyl-3,6-dihydro-2H-pyridin-1-yl]ethanone.
| Compound Name | 2-(2-ethylimidazol-1-yl)-1-[(2R,6R)-6-methyl-2-prop-2-enyl-3,6-dihydro-2H-pyridin-1-yl]ethanone |
|---|---|
| PubChem CID | 56871766 |
| Molecular Formula | C16H23N3O |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.18 |
| IUPAC Name | 2-(2-ethylimidazol-1-yl)-1-[(2R,6R)-6-methyl-2-prop-2-enyl-3,6-dihydro-2H-pyridin-1-yl]ethanone |
| SMILES | C=CC[C@@H]1CC=C[C@@H](C)N1C(=O)Cn1ccnc1CC |
| InChI | InChI=1S/C16H23N3O/c1-4-7-14-9-6-8-13(3)19(14)16(20)12-18-11-10-17-15(18)5-2/h4,6,8,10-11,13-14H,1,5,7,9,12H2,2-3H3/t13-,14-/m1/s1 |
| InChIKey | GOCBOFPTCQIJIN-ZIAGYGMSSA-N |
| XLogP | 2.57 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|