C18H26N4O3 — CID 56871850
4-[2-[cyclohexyl(methyl)amino]pyridine-3-carbonyl]piperazine-2-carboxylic acid (PubChem CID 56871850) has the molecular formula C18H26N4O3 and a molecular weight of 346.43 g/mol. Its IUPAC name is 4-[2-[cyclohexyl(methyl)amino]pyridine-3-carbonyl]piperazine-2-carboxylic acid.
| Compound Name | 4-[2-[cyclohexyl(methyl)amino]pyridine-3-carbonyl]piperazine-2-carboxylic acid |
|---|---|
| PubChem CID | 56871850 |
| Molecular Formula | C18H26N4O3 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.20 |
| IUPAC Name | 4-[2-[cyclohexyl(methyl)amino]pyridine-3-carbonyl]piperazine-2-carboxylic acid |
| SMILES | CN(c1ncccc1C(=O)N1CCNC(C(=O)O)C1)C1CCCCC1 |
| InChI | InChI=1S/C18H26N4O3/c1-21(13-6-3-2-4-7-13)16-14(8-5-9-20-16)17(23)22-11-10-19-15(12-22)18(24)25/h5,8-9,13,15,19H,2-4,6-7,10-12H2,1H3,(H,24,25) |
| InChIKey | VPLFLWIWOWPPEP-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 85.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |