About 4-(4-methylsulfonylphenyl)-1H-pyrrolo[2,3-b]pyridin-6-amine
4-(4-methylsulfonylphenyl)-1H-pyrrolo[2,3-b]pyridin-6-amine (PubChem CID 56873902) has the molecular formula C14H13N3O2S
and a molecular weight of 287.34 g/mol. Its IUPAC name is 4-(4-methylsulfonylphenyl)-1H-pyrrolo[2,3-b]pyridin-6-amine.
Molecular Properties
| Compound Name | 4-(4-methylsulfonylphenyl)-1H-pyrrolo[2,3-b]pyridin-6-amine |
| PubChem CID | 56873902 |
| Molecular Formula | C14H13N3O2S |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.07 |
| IUPAC Name | 4-(4-methylsulfonylphenyl)-1H-pyrrolo[2,3-b]pyridin-6-amine |
| SMILES | CS(=O)(=O)c1ccc(-c2cc(N)nc3[nH]ccc23)cc1 |
| InChI | InChI=1S/C14H13N3O2S/c1-20(18,19)10-4-2-9(3-5-10)12-8-13(15)17-14-11(12)6-7-16-14/h2-8H,1H3,(H3,15,16,17) |
| InChIKey | WFJDUSOQTBPQOO-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 88.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(4-methylsulfonylphenyl)-1H-pyrrolo[2,3-b]pyridin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-methylsulfonylphenyl)-1H-pyrrolo[2,3-b]pyridin-6-amine?
The IUPAC name of 4-(4-methylsulfonylphenyl)-1H-pyrrolo[2,3-b]pyridin-6-amine (CID 56873902) is 4-(4-methylsulfonylphenyl)-1H-pyrrolo[2,3-b]pyridin-6-amine.
What is the SMILES notation for 4-(4-methylsulfonylphenyl)-1H-pyrrolo[2,3-b]pyridin-6-amine?
The canonical SMILES for 4-(4-methylsulfonylphenyl)-1H-pyrrolo[2,3-b]pyridin-6-amine is CS(=O)(=O)c1ccc(-c2cc(N)nc3[nH]ccc23)cc1.
What is the InChIKey of 4-(4-methylsulfonylphenyl)-1H-pyrrolo[2,3-b]pyridin-6-amine?
The InChIKey is WFJDUSOQTBPQOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13N3O2S/c1-20(18,19)10-4-2-9(3-5-10)12-8-13(15)17-14-11(12)6-7-16-14/h2-8H,1H3,(H3,15,16,17).
What are the key properties of 4-(4-methylsulfonylphenyl)-1H-pyrrolo[2,3-b]pyridin-6-amine?
4-(4-methylsulfonylphenyl)-1H-pyrrolo[2,3-b]pyridin-6-amine has a molecular weight of 287.34 g/mol, XLogP of 2.22, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-methylsulfonylphenyl)-1H-pyrrolo[2,3-b]pyridin-6-amine is sourced from PubChem (CID 56873902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).