C13H12N4O2S — CID 141391150
2-(4-methylphenyl)sulfonyl-7H-pyrrolo[2,3-d]pyrimidin-4-amine (PubChem CID 141391150) has the molecular formula C13H12N4O2S and a molecular weight of 288.33 g/mol. Its IUPAC name is 2-(4-methylphenyl)sulfonyl-7H-pyrrolo[2,3-d]pyrimidin-4-amine.
| Compound Name | 2-(4-methylphenyl)sulfonyl-7H-pyrrolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 141391150 |
| Molecular Formula | C13H12N4O2S |
| Molecular Weight | 288.33 g/mol |
| Exact Mass | 288.07 |
| IUPAC Name | 2-(4-methylphenyl)sulfonyl-7H-pyrrolo[2,3-d]pyrimidin-4-amine |
| SMILES | Cc1ccc(S(=O)(=O)c2nc(N)c3cc[nH]c3n2)cc1 |
| InChI | InChI=1S/C13H12N4O2S/c1-8-2-4-9(5-3-8)20(18,19)13-16-11(14)10-6-7-15-12(10)17-13/h2-7H,1H3,(H3,14,15,16,17) |
| InChIKey | QUQAKXJMBYXCNV-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.33 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |