About 4-bromo-7-(4-methylphenyl)sulfonyl-1H-pyrrolo[2,3-c]pyridine
4-bromo-7-(4-methylphenyl)sulfonyl-1H-pyrrolo[2,3-c]pyridine (PubChem CID 121335226) has the molecular formula C14H11BrN2O2S
and a molecular weight of 351.23 g/mol. Its IUPAC name is 4-bromo-7-(4-methylphenyl)sulfonyl-1H-pyrrolo[2,3-c]pyridine.
Molecular Properties
| Compound Name | 4-bromo-7-(4-methylphenyl)sulfonyl-1H-pyrrolo[2,3-c]pyridine |
| PubChem CID | 121335226 |
| Molecular Formula | C14H11BrN2O2S |
| Molecular Weight | 351.23 g/mol |
| Exact Mass | 349.97 |
| IUPAC Name | 4-bromo-7-(4-methylphenyl)sulfonyl-1H-pyrrolo[2,3-c]pyridine |
| SMILES | Cc1ccc(S(=O)(=O)c2ncc(Br)c3cc[nH]c23)cc1 |
| InChI | InChI=1S/C14H11BrN2O2S/c1-9-2-4-10(5-3-9)20(18,19)14-13-11(6-7-16-13)12(15)8-17-14/h2-8,16H,1H3 |
| InChIKey | LQILMUOCUPTRRH-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 62.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.23 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-bromo-7-(4-methylphenyl)sulfonyl-1H-pyrrolo[2,3-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-7-(4-methylphenyl)sulfonyl-1H-pyrrolo[2,3-c]pyridine?
The IUPAC name of 4-bromo-7-(4-methylphenyl)sulfonyl-1H-pyrrolo[2,3-c]pyridine (CID 121335226) is 4-bromo-7-(4-methylphenyl)sulfonyl-1H-pyrrolo[2,3-c]pyridine.
What is the SMILES notation for 4-bromo-7-(4-methylphenyl)sulfonyl-1H-pyrrolo[2,3-c]pyridine?
The canonical SMILES for 4-bromo-7-(4-methylphenyl)sulfonyl-1H-pyrrolo[2,3-c]pyridine is Cc1ccc(S(=O)(=O)c2ncc(Br)c3cc[nH]c23)cc1.
What is the InChIKey of 4-bromo-7-(4-methylphenyl)sulfonyl-1H-pyrrolo[2,3-c]pyridine?
The InChIKey is LQILMUOCUPTRRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11BrN2O2S/c1-9-2-4-10(5-3-9)20(18,19)14-13-11(6-7-16-13)12(15)8-17-14/h2-8,16H,1H3.
What are the key properties of 4-bromo-7-(4-methylphenyl)sulfonyl-1H-pyrrolo[2,3-c]pyridine?
4-bromo-7-(4-methylphenyl)sulfonyl-1H-pyrrolo[2,3-c]pyridine has a molecular weight of 351.23 g/mol, XLogP of 3.47, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-7-(4-methylphenyl)sulfonyl-1H-pyrrolo[2,3-c]pyridine is sourced from PubChem (CID 121335226), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).