C14H10BrClN2O2S — CID 91092393
3-bromo-4-chloro-7-(4-methylphenyl)sulfonyl-1H-pyrrolo[3,2-c]pyridine (PubChem CID 91092393) has the molecular formula C14H10BrClN2O2S and a molecular weight of 385.67 g/mol. Its IUPAC name is 3-bromo-4-chloro-7-(4-methylphenyl)sulfonyl-1H-pyrrolo[3,2-c]pyridine.
| Compound Name | 3-bromo-4-chloro-7-(4-methylphenyl)sulfonyl-1H-pyrrolo[3,2-c]pyridine |
|---|---|
| PubChem CID | 91092393 |
| Molecular Formula | C14H10BrClN2O2S |
| Molecular Weight | 385.67 g/mol |
| Exact Mass | 383.93 |
| IUPAC Name | 3-bromo-4-chloro-7-(4-methylphenyl)sulfonyl-1H-pyrrolo[3,2-c]pyridine |
| SMILES | Cc1ccc(S(=O)(=O)c2cnc(Cl)c3c(Br)c[nH]c23)cc1 |
| InChI | InChI=1S/C14H10BrClN2O2S/c1-8-2-4-9(5-3-8)21(19,20)11-7-18-14(16)12-10(15)6-17-13(11)12/h2-7,17H,1H3 |
| InChIKey | BLYBOHCREWNVJS-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 62.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.67 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|