C15H16N2O4S — CID 56875756
2-(3,4-dihydro-1H-isoquinolin-2-yl)-N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-2-oxoacetamide (PubChem CID 56875756) has the molecular formula C15H16N2O4S and a molecular weight of 320.37 g/mol. Its IUPAC name is 2-(3,4-dihydro-1H-isoquinolin-2-yl)-N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-2-oxoacetamide.
| Compound Name | 2-(3,4-dihydro-1H-isoquinolin-2-yl)-N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-2-oxoacetamide |
|---|---|
| PubChem CID | 56875756 |
| Molecular Formula | C15H16N2O4S |
| Molecular Weight | 320.37 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | 2-(3,4-dihydro-1H-isoquinolin-2-yl)-N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-2-oxoacetamide |
| SMILES | O=C(NC1C=CS(=O)(=O)C1)C(=O)N1CCc2ccccc2C1 |
| InChI | InChI=1S/C15H16N2O4S/c18-14(16-13-6-8-22(20,21)10-13)15(19)17-7-5-11-3-1-2-4-12(11)9-17/h1-4,6,8,13H,5,7,9-10H2,(H,16,18) |
| InChIKey | LJSABJXTUMWSFA-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.37 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|