C22H26N2O4 — CID 56877849
2-(3-benzyl-1-methyl-2-oxoindol-3-yl)-N,N-bis(2-hydroxyethyl)acetamide (PubChem CID 56877849) has the molecular formula C22H26N2O4 and a molecular weight of 382.46 g/mol. Its IUPAC name is 2-(3-benzyl-1-methyl-2-oxoindol-3-yl)-N,N-bis(2-hydroxyethyl)acetamide.
| Compound Name | 2-(3-benzyl-1-methyl-2-oxoindol-3-yl)-N,N-bis(2-hydroxyethyl)acetamide |
|---|---|
| PubChem CID | 56877849 |
| Molecular Formula | C22H26N2O4 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | 2-(3-benzyl-1-methyl-2-oxoindol-3-yl)-N,N-bis(2-hydroxyethyl)acetamide |
| SMILES | CN1C(=O)C(CC(=O)N(CCO)CCO)(Cc2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C22H26N2O4/c1-23-19-10-6-5-9-18(19)22(21(23)28,15-17-7-3-2-4-8-17)16-20(27)24(11-13-25)12-14-26/h2-10,25-26H,11-16H2,1H3 |
| InChIKey | RERWEHQXOAHOIK-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |