C22H22N2O2 — CID 56866029
3-benzyl-3-[2-(2,5-dihydropyrrol-1-yl)-2-oxoethyl]-1-methylindol-2-one (PubChem CID 56866029) has the molecular formula C22H22N2O2 and a molecular weight of 346.43 g/mol. Its IUPAC name is 3-benzyl-3-[2-(2,5-dihydropyrrol-1-yl)-2-oxoethyl]-1-methylindol-2-one.
| Compound Name | 3-benzyl-3-[2-(2,5-dihydropyrrol-1-yl)-2-oxoethyl]-1-methylindol-2-one |
|---|---|
| PubChem CID | 56866029 |
| Molecular Formula | C22H22N2O2 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.17 |
| IUPAC Name | 3-benzyl-3-[2-(2,5-dihydropyrrol-1-yl)-2-oxoethyl]-1-methylindol-2-one |
| SMILES | CN1C(=O)C(CC(=O)N2CC=CC2)(Cc2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C22H22N2O2/c1-23-19-12-6-5-11-18(19)22(21(23)26,15-17-9-3-2-4-10-17)16-20(25)24-13-7-8-14-24/h2-12H,13-16H2,1H3 |
| InChIKey | MWBOYCMNLNJKBT-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|