C24H25N3O2 — CID 95525386
1-[2-[(3S)-3-benzyl-1-methyl-2-oxoindol-3-yl]acetyl]piperidine-4-carbonitrile (PubChem CID 95525386) has the molecular formula C24H25N3O2 and a molecular weight of 387.48 g/mol. Its IUPAC name is 1-[2-[(3S)-3-benzyl-1-methyl-2-oxoindol-3-yl]acetyl]piperidine-4-carbonitrile.
| Compound Name | 1-[2-[(3S)-3-benzyl-1-methyl-2-oxoindol-3-yl]acetyl]piperidine-4-carbonitrile |
|---|---|
| PubChem CID | 95525386 |
| Molecular Formula | C24H25N3O2 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.19 |
| IUPAC Name | 1-[2-[(3S)-3-benzyl-1-methyl-2-oxoindol-3-yl]acetyl]piperidine-4-carbonitrile |
| SMILES | CN1C(=O)[C@](CC(=O)N2CCC(C#N)CC2)(Cc2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C24H25N3O2/c1-26-21-10-6-5-9-20(21)24(23(26)29,15-18-7-3-2-4-8-18)16-22(28)27-13-11-19(17-25)12-14-27/h2-10,19H,11-16H2,1H3/t24-/m0/s1 |
| InChIKey | PFUYAZKJXLBDFF-DEOSSOPVSA-N |
| XLogP | 3.30 |
| TPSA | 64.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |