C24H29N3O2 — CID 95400748
2-[(3R)-3-benzyl-1-methyl-2-oxoindol-3-yl]-N-(piperidin-4-ylmethyl)acetamide (PubChem CID 95400748) has the molecular formula C24H29N3O2 and a molecular weight of 391.51 g/mol. Its IUPAC name is 2-[(3R)-3-benzyl-1-methyl-2-oxoindol-3-yl]-N-(piperidin-4-ylmethyl)acetamide.
| Compound Name | 2-[(3R)-3-benzyl-1-methyl-2-oxoindol-3-yl]-N-(piperidin-4-ylmethyl)acetamide |
|---|---|
| PubChem CID | 95400748 |
| Molecular Formula | C24H29N3O2 |
| Molecular Weight | 391.51 g/mol |
| Exact Mass | 391.23 |
| IUPAC Name | 2-[(3R)-3-benzyl-1-methyl-2-oxoindol-3-yl]-N-(piperidin-4-ylmethyl)acetamide |
| SMILES | CN1C(=O)[C@@](CC(=O)NCC2CCNCC2)(Cc2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C24H29N3O2/c1-27-21-10-6-5-9-20(21)24(23(27)29,15-18-7-3-2-4-8-18)16-22(28)26-17-19-11-13-25-14-12-19/h2-10,19,25H,11-17H2,1H3,(H,26,28)/t24-/m1/s1 |
| InChIKey | KHLCSWFBBZTFIZ-XMMPIXPASA-N |
| XLogP | 2.65 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.51 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |