C22H26ClN3O2 — CID 154892331
3-benzyl-1-methyl-3-(2-oxo-2-piperazin-1-ylethyl)indol-2-one;hydrochloride (PubChem CID 154892331) has the molecular formula C22H26ClN3O2 and a molecular weight of 399.92 g/mol. Its IUPAC name is 3-benzyl-1-methyl-3-(2-oxo-2-piperazin-1-ylethyl)indol-2-one;hydrochloride.
| Compound Name | 3-benzyl-1-methyl-3-(2-oxo-2-piperazin-1-ylethyl)indol-2-one;hydrochloride |
|---|---|
| PubChem CID | 154892331 |
| Molecular Formula | C22H26ClN3O2 |
| Molecular Weight | 399.92 g/mol |
| Exact Mass | 399.17 |
| IUPAC Name | 3-benzyl-1-methyl-3-(2-oxo-2-piperazin-1-ylethyl)indol-2-one;hydrochloride |
| SMILES | CN1C(=O)C(CC(=O)N2CCNCC2)(Cc2ccccc2)c2ccccc21.Cl |
| InChI | InChI=1S/C22H25N3O2.ClH/c1-24-19-10-6-5-9-18(19)22(21(24)27,15-17-7-3-2-4-8-17)16-20(26)25-13-11-23-12-14-25;/h2-10,23H,11-16H2,1H3;1H |
| InChIKey | MJHFBANZMASQCJ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.92 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |