C24H29N3O2 — CID 95557356
(3S)-3-benzyl-3-[3-(1,4-diazepan-1-yl)-3-oxopropyl]-1-methylindol-2-one (PubChem CID 95557356) has the molecular formula C24H29N3O2 and a molecular weight of 391.52 g/mol. Its IUPAC name is (3S)-3-benzyl-3-[3-(1,4-diazepan-1-yl)-3-oxopropyl]-1-methylindol-2-one.
| Compound Name | (3S)-3-benzyl-3-[3-(1,4-diazepan-1-yl)-3-oxopropyl]-1-methylindol-2-one |
|---|---|
| PubChem CID | 95557356 |
| Molecular Formula | C24H29N3O2 |
| Molecular Weight | 391.52 g/mol |
| Exact Mass | 391.23 |
| IUPAC Name | (3S)-3-benzyl-3-[3-(1,4-diazepan-1-yl)-3-oxopropyl]-1-methylindol-2-one |
| SMILES | CN1C(=O)[C@@](CCC(=O)N2CCCNCC2)(Cc2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C24H29N3O2/c1-26-21-11-6-5-10-20(21)24(23(26)29,18-19-8-3-2-4-9-19)13-12-22(28)27-16-7-14-25-15-17-27/h2-6,8-11,25H,7,12-18H2,1H3/t24-/m0/s1 |
| InChIKey | AVPAHXAAHPBPEX-DEOSSOPVSA-N |
| XLogP | 2.75 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.52 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |