C14H16F3N5O — CID 56878322
2-ethyl-N-[2-[4-methyl-6-(trifluoromethyl)pyrimidin-2-yl]ethyl]pyrazole-3-carboxamide (PubChem CID 56878322) has the molecular formula C14H16F3N5O and a molecular weight of 327.31 g/mol. Its IUPAC name is 2-ethyl-N-[2-[4-methyl-6-(trifluoromethyl)pyrimidin-2-yl]ethyl]pyrazole-3-carboxamide.
| Compound Name | 2-ethyl-N-[2-[4-methyl-6-(trifluoromethyl)pyrimidin-2-yl]ethyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 56878322 |
| Molecular Formula | C14H16F3N5O |
| Molecular Weight | 327.31 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | 2-ethyl-N-[2-[4-methyl-6-(trifluoromethyl)pyrimidin-2-yl]ethyl]pyrazole-3-carboxamide |
| SMILES | CCn1nccc1C(=O)NCCc1nc(C)cc(C(F)(F)F)n1 |
| InChI | InChI=1S/C14H16F3N5O/c1-3-22-10(4-7-19-22)13(23)18-6-5-12-20-9(2)8-11(21-12)14(15,16)17/h4,7-8H,3,5-6H2,1-2H3,(H,18,23) |
| InChIKey | DFTXWUDJAMUYQY-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.31 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |