C23H25N3O2 — CID 56879229
2-[1-[(1-methyl-4-phenylpiperidin-4-yl)methyl]imidazol-2-yl]benzoic acid (PubChem CID 56879229) has the molecular formula C23H25N3O2 and a molecular weight of 375.47 g/mol. Its IUPAC name is 2-[1-[(1-methyl-4-phenylpiperidin-4-yl)methyl]imidazol-2-yl]benzoic acid.
| Compound Name | 2-[1-[(1-methyl-4-phenylpiperidin-4-yl)methyl]imidazol-2-yl]benzoic acid |
|---|---|
| PubChem CID | 56879229 |
| Molecular Formula | C23H25N3O2 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.19 |
| IUPAC Name | 2-[1-[(1-methyl-4-phenylpiperidin-4-yl)methyl]imidazol-2-yl]benzoic acid |
| SMILES | CN1CCC(Cn2ccnc2-c2ccccc2C(=O)O)(c2ccccc2)CC1 |
| InChI | InChI=1S/C23H25N3O2/c1-25-14-11-23(12-15-25,18-7-3-2-4-8-18)17-26-16-13-24-21(26)19-9-5-6-10-20(19)22(27)28/h2-10,13,16H,11-12,14-15,17H2,1H3,(H,27,28) |
| InChIKey | WGRJVOYSLAOTIP-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |