C22H35N5O — CID 142821686
3-amino-N-[(1-methyl-4-phenylpiperidin-4-yl)methyl]pyrazine-2-carboxamide;ethane (PubChem CID 142821686) has the molecular formula C22H35N5O and a molecular weight of 385.56 g/mol. Its IUPAC name is 3-amino-N-[(1-methyl-4-phenylpiperidin-4-yl)methyl]pyrazine-2-carboxamide;ethane.
| Compound Name | 3-amino-N-[(1-methyl-4-phenylpiperidin-4-yl)methyl]pyrazine-2-carboxamide;ethane |
|---|---|
| PubChem CID | 142821686 |
| Molecular Formula | C22H35N5O |
| Molecular Weight | 385.56 g/mol |
| Exact Mass | 385.28 |
| IUPAC Name | 3-amino-N-[(1-methyl-4-phenylpiperidin-4-yl)methyl]pyrazine-2-carboxamide;ethane |
| SMILES | CC.CC.CN1CCC(CNC(=O)c2nccnc2N)(c2ccccc2)CC1 |
| InChI | InChI=1S/C18H23N5O.2C2H6/c1-23-11-7-18(8-12-23,14-5-3-2-4-6-14)13-22-17(24)15-16(19)21-10-9-20-15;2*1-2/h2-6,9-10H,7-8,11-13H2,1H3,(H2,19,21)(H,22,24);2*1-2H3 |
| InChIKey | OABCEVWXQCEAOH-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.56 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |