C19H26N6O3S — CID 22240827
3-amino-N-[[1-(dimethylsulfamoyl)-4-phenylpiperidin-4-yl]methyl]pyrazine-2-carboxamide (PubChem CID 22240827) has the molecular formula C19H26N6O3S and a molecular weight of 418.52 g/mol. Its IUPAC name is 3-amino-N-[[1-(dimethylsulfamoyl)-4-phenylpiperidin-4-yl]methyl]pyrazine-2-carboxamide.
| Compound Name | 3-amino-N-[[1-(dimethylsulfamoyl)-4-phenylpiperidin-4-yl]methyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 22240827 |
| Molecular Formula | C19H26N6O3S |
| Molecular Weight | 418.52 g/mol |
| Exact Mass | 418.18 |
| IUPAC Name | 3-amino-N-[[1-(dimethylsulfamoyl)-4-phenylpiperidin-4-yl]methyl]pyrazine-2-carboxamide |
| SMILES | CN(C)S(=O)(=O)N1CCC(CNC(=O)c2nccnc2N)(c2ccccc2)CC1 |
| InChI | InChI=1S/C19H26N6O3S/c1-24(2)29(27,28)25-12-8-19(9-13-25,15-6-4-3-5-7-15)14-23-18(26)16-17(20)22-11-10-21-16/h3-7,10-11H,8-9,12-14H2,1-2H3,(H2,20,22)(H,23,26) |
| InChIKey | QCHACBDJNQDDAY-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.52 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |