C19H22N8O — CID 89126639
3-amino-N-[[1-(N'-cyanocarbamimidoyl)-4-phenylpiperidin-4-yl]methyl]pyrazine-2-carboxamide (PubChem CID 89126639) has the molecular formula C19H22N8O and a molecular weight of 378.44 g/mol. Its IUPAC name is 3-amino-N-[[1-(N'-cyanocarbamimidoyl)-4-phenylpiperidin-4-yl]methyl]pyrazine-2-carboxamide.
| Compound Name | 3-amino-N-[[1-(N'-cyanocarbamimidoyl)-4-phenylpiperidin-4-yl]methyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 89126639 |
| Molecular Formula | C19H22N8O |
| Molecular Weight | 378.44 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | 3-amino-N-[[1-(N'-cyanocarbamimidoyl)-4-phenylpiperidin-4-yl]methyl]pyrazine-2-carboxamide |
| SMILES | N#C/N=C(\N)N1CCC(CNC(=O)c2nccnc2N)(c2ccccc2)CC1 |
| InChI | InChI=1S/C19H22N8O/c20-13-26-18(22)27-10-6-19(7-11-27,14-4-2-1-3-5-14)12-25-17(28)15-16(21)24-9-8-23-15/h1-5,8-9H,6-7,10-12H2,(H2,21,24)(H2,22,26)(H,25,28) |
| InChIKey | QGIOVBCUVPVJPC-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 146.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.44 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|