C20H24N6O3S — CID 76826294
3-amino-N-[[1-(1-methylsulfanyl-2-nitroethenyl)-4-phenylpiperidin-4-yl]methyl]pyrazine-2-carboxamide (PubChem CID 76826294) has the molecular formula C20H24N6O3S and a molecular weight of 428.52 g/mol. Its IUPAC name is 3-amino-N-[[1-(1-methylsulfanyl-2-nitroethenyl)-4-phenylpiperidin-4-yl]methyl]pyrazine-2-carboxamide.
| Compound Name | 3-amino-N-[[1-(1-methylsulfanyl-2-nitroethenyl)-4-phenylpiperidin-4-yl]methyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 76826294 |
| Molecular Formula | C20H24N6O3S |
| Molecular Weight | 428.52 g/mol |
| Exact Mass | 428.16 |
| IUPAC Name | 3-amino-N-[[1-(1-methylsulfanyl-2-nitroethenyl)-4-phenylpiperidin-4-yl]methyl]pyrazine-2-carboxamide |
| SMILES | CSC(=C[N+](=O)[O-])N1CCC(CNC(=O)c2nccnc2N)(c2ccccc2)CC1 |
| InChI | InChI=1S/C20H24N6O3S/c1-30-16(13-26(28)29)25-11-7-20(8-12-25,15-5-3-2-4-6-15)14-24-19(27)17-18(21)23-10-9-22-17/h2-6,9-10,13H,7-8,11-12,14H2,1H3,(H2,21,23)(H,24,27) |
| InChIKey | AIEVWAHBRPIJGT-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 127.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.52 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|