C20H30N2O3 — CID 56883083
1-[(4-aminocyclohexyl)methyl]-4-(3-methylphenoxy)piperidine-4-carboxylic acid (PubChem CID 56883083) has the molecular formula C20H30N2O3 and a molecular weight of 346.47 g/mol. Its IUPAC name is 1-[(4-aminocyclohexyl)methyl]-4-(3-methylphenoxy)piperidine-4-carboxylic acid.
| Compound Name | 1-[(4-aminocyclohexyl)methyl]-4-(3-methylphenoxy)piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 56883083 |
| Molecular Formula | C20H30N2O3 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.23 |
| IUPAC Name | 1-[(4-aminocyclohexyl)methyl]-4-(3-methylphenoxy)piperidine-4-carboxylic acid |
| SMILES | Cc1cccc(OC2(C(=O)O)CCN(CC3CCC(N)CC3)CC2)c1 |
| InChI | InChI=1S/C20H30N2O3/c1-15-3-2-4-18(13-15)25-20(19(23)24)9-11-22(12-10-20)14-16-5-7-17(21)8-6-16/h2-4,13,16-17H,5-12,14,21H2,1H3,(H,23,24) |
| InChIKey | HDIVDOQMPTUVBA-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 75.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |