C18H19N3O5 — CID 56890009
4-(3-methylphenoxy)-1-(6-oxo-1H-pyrimidine-5-carbonyl)piperidine-4-carboxylic acid (PubChem CID 56890009) has the molecular formula C18H19N3O5 and a molecular weight of 357.37 g/mol. Its IUPAC name is 4-(3-methylphenoxy)-1-(6-oxo-1H-pyrimidine-5-carbonyl)piperidine-4-carboxylic acid.
| Compound Name | 4-(3-methylphenoxy)-1-(6-oxo-1H-pyrimidine-5-carbonyl)piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 56890009 |
| Molecular Formula | C18H19N3O5 |
| Molecular Weight | 357.37 g/mol |
| Exact Mass | 357.13 |
| IUPAC Name | 4-(3-methylphenoxy)-1-(6-oxo-1H-pyrimidine-5-carbonyl)piperidine-4-carboxylic acid |
| SMILES | Cc1cccc(OC2(C(=O)O)CCN(C(=O)c3cnc[nH]c3=O)CC2)c1 |
| InChI | InChI=1S/C18H19N3O5/c1-12-3-2-4-13(9-12)26-18(17(24)25)5-7-21(8-6-18)16(23)14-10-19-11-20-15(14)22/h2-4,9-11H,5-8H2,1H3,(H,24,25)(H,19,20,22) |
| InChIKey | JEHQOXMBUUMUOR-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 112.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.37 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |