C18H20N4O4 — CID 70773035
1-[2-(methylamino)pyrimidine-5-carbonyl]-4-phenoxypiperidine-4-carboxylic acid (PubChem CID 70773035) has the molecular formula C18H20N4O4 and a molecular weight of 356.38 g/mol. Its IUPAC name is 1-[2-(methylamino)pyrimidine-5-carbonyl]-4-phenoxypiperidine-4-carboxylic acid.
| Compound Name | 1-[2-(methylamino)pyrimidine-5-carbonyl]-4-phenoxypiperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 70773035 |
| Molecular Formula | C18H20N4O4 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | 1-[2-(methylamino)pyrimidine-5-carbonyl]-4-phenoxypiperidine-4-carboxylic acid |
| SMILES | CNc1ncc(C(=O)N2CCC(Oc3ccccc3)(C(=O)O)CC2)cn1 |
| InChI | InChI=1S/C18H20N4O4/c1-19-17-20-11-13(12-21-17)15(23)22-9-7-18(8-10-22,16(24)25)26-14-5-3-2-4-6-14/h2-6,11-12H,7-10H2,1H3,(H,24,25)(H,19,20,21) |
| InChIKey | XINBHOFOHFENSU-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 104.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |