C18H24N6 — CID 56885388
N'-(2-cyclopentyl-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidin-4-yl)-N-pyridin-3-ylethane-1,2-diamine (PubChem CID 56885388) has the molecular formula C18H24N6 and a molecular weight of 324.43 g/mol. Its IUPAC name is N'-(2-cyclopentyl-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidin-4-yl)-N-pyridin-3-ylethane-1,2-diamine.
| Compound Name | N'-(2-cyclopentyl-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidin-4-yl)-N-pyridin-3-ylethane-1,2-diamine |
|---|---|
| PubChem CID | 56885388 |
| Molecular Formula | C18H24N6 |
| Molecular Weight | 324.43 g/mol |
| Exact Mass | 324.21 |
| IUPAC Name | N'-(2-cyclopentyl-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidin-4-yl)-N-pyridin-3-ylethane-1,2-diamine |
| SMILES | c1cncc(NCCNc2nc(C3CCCC3)nc3c2CNC3)c1 |
| InChI | InChI=1S/C18H24N6/c1-2-5-13(4-1)17-23-16-12-20-11-15(16)18(24-17)22-9-8-21-14-6-3-7-19-10-14/h3,6-7,10,13,20-21H,1-2,4-5,8-9,11-12H2,(H,22,23,24) |
| InChIKey | DDUXGHWTOWXPDR-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 74.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.43 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|