C18H19F2NO3 — CID 56886222
1-[[4-(difluoromethoxy)phenyl]methyl]-3-(2-methoxyphenoxy)azetidine (PubChem CID 56886222) has the molecular formula C18H19F2NO3 and a molecular weight of 335.35 g/mol. Its IUPAC name is 1-[[4-(difluoromethoxy)phenyl]methyl]-3-(2-methoxyphenoxy)azetidine.
| Compound Name | 1-[[4-(difluoromethoxy)phenyl]methyl]-3-(2-methoxyphenoxy)azetidine |
|---|---|
| PubChem CID | 56886222 |
| Molecular Formula | C18H19F2NO3 |
| Molecular Weight | 335.35 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | 1-[[4-(difluoromethoxy)phenyl]methyl]-3-(2-methoxyphenoxy)azetidine |
| SMILES | COc1ccccc1OC1CN(Cc2ccc(OC(F)F)cc2)C1 |
| InChI | InChI=1S/C18H19F2NO3/c1-22-16-4-2-3-5-17(16)23-15-11-21(12-15)10-13-6-8-14(9-7-13)24-18(19)20/h2-9,15,18H,10-12H2,1H3 |
| InChIKey | YLLVOZFZJHCEPK-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.35 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |