C15H17N7 — CID 56886303
5-[[methyl-[(1-phenyltriazol-4-yl)methyl]amino]methyl]pyrimidin-2-amine (PubChem CID 56886303) has the molecular formula C15H17N7 and a molecular weight of 295.35 g/mol. Its IUPAC name is 5-[[methyl-[(1-phenyltriazol-4-yl)methyl]amino]methyl]pyrimidin-2-amine.
| Compound Name | 5-[[methyl-[(1-phenyltriazol-4-yl)methyl]amino]methyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 56886303 |
| Molecular Formula | C15H17N7 |
| Molecular Weight | 295.35 g/mol |
| Exact Mass | 295.15 |
| IUPAC Name | 5-[[methyl-[(1-phenyltriazol-4-yl)methyl]amino]methyl]pyrimidin-2-amine |
| SMILES | CN(Cc1cnc(N)nc1)Cc1cn(-c2ccccc2)nn1 |
| InChI | InChI=1S/C15H17N7/c1-21(9-12-7-17-15(16)18-8-12)10-13-11-22(20-19-13)14-5-3-2-4-6-14/h2-8,11H,9-10H2,1H3,(H2,16,17,18) |
| InChIKey | JQWGMJGIBMEFLN-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 85.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.35 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |