C13H21N3O2 — CID 56886360
2-butoxy-1-(5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepin-8-yl)ethanone (PubChem CID 56886360) has the molecular formula C13H21N3O2 and a molecular weight of 251.33 g/mol. Its IUPAC name is 2-butoxy-1-(5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepin-8-yl)ethanone.
| Compound Name | 2-butoxy-1-(5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepin-8-yl)ethanone |
|---|---|
| PubChem CID | 56886360 |
| Molecular Formula | C13H21N3O2 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.16 |
| IUPAC Name | 2-butoxy-1-(5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepin-8-yl)ethanone |
| SMILES | CCCCOCC(=O)N1CCCn2cncc2C1 |
| InChI | InChI=1S/C13H21N3O2/c1-2-3-7-18-10-13(17)15-5-4-6-16-11-14-8-12(16)9-15/h8,11H,2-7,9-10H2,1H3 |
| InChIKey | OIAXIXDPHGTLBZ-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|