C20H27N3O4 — CID 56886383
1-[3-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]piperidin-1-yl]propane-1,2-dione (PubChem CID 56886383) has the molecular formula C20H27N3O4 and a molecular weight of 373.45 g/mol. Its IUPAC name is 1-[3-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]piperidin-1-yl]propane-1,2-dione.
| Compound Name | 1-[3-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]piperidin-1-yl]propane-1,2-dione |
|---|---|
| PubChem CID | 56886383 |
| Molecular Formula | C20H27N3O4 |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.20 |
| IUPAC Name | 1-[3-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]piperidin-1-yl]propane-1,2-dione |
| SMILES | CC(=O)C(=O)N1CCCC(N2CCN(Cc3ccc4c(c3)OCO4)CC2)C1 |
| InChI | InChI=1S/C20H27N3O4/c1-15(24)20(25)23-6-2-3-17(13-23)22-9-7-21(8-10-22)12-16-4-5-18-19(11-16)27-14-26-18/h4-5,11,17H,2-3,6-10,12-14H2,1H3 |
| InChIKey | WKCUSRCUJXSRQO-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 62.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|