C22H32N4O4 — CID 56908703
2-[3-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]piperidin-1-yl]-2-oxo-N-propan-2-ylacetamide (PubChem CID 56908703) has the molecular formula C22H32N4O4 and a molecular weight of 416.52 g/mol. Its IUPAC name is 2-[3-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]piperidin-1-yl]-2-oxo-N-propan-2-ylacetamide.
| Compound Name | 2-[3-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]piperidin-1-yl]-2-oxo-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 56908703 |
| Molecular Formula | C22H32N4O4 |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.24 |
| IUPAC Name | 2-[3-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]piperidin-1-yl]-2-oxo-N-propan-2-ylacetamide |
| SMILES | CC(C)NC(=O)C(=O)N1CCCC(N2CCN(Cc3ccc4c(c3)OCO4)CC2)C1 |
| InChI | InChI=1S/C22H32N4O4/c1-16(2)23-21(27)22(28)26-7-3-4-18(14-26)25-10-8-24(9-11-25)13-17-5-6-19-20(12-17)30-15-29-19/h5-6,12,16,18H,3-4,7-11,13-15H2,1-2H3,(H,23,27) |
| InChIKey | CJOVOTWIAGCIPK-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 74.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|