C20H30N4O2 — CID 56891558
(4aS,8aR)-1-[2-(methylamino)ethyl]-N-[(3-methylphenyl)methyl]-2-oxo-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridine-6-carboxamide (PubChem CID 56891558) has the molecular formula C20H30N4O2 and a molecular weight of 358.49 g/mol. Its IUPAC name is (4aS,8aR)-1-[2-(methylamino)ethyl]-N-[(3-methylphenyl)methyl]-2-oxo-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridine-6-carboxamide.
| Compound Name | (4aS,8aR)-1-[2-(methylamino)ethyl]-N-[(3-methylphenyl)methyl]-2-oxo-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridine-6-carboxamide |
|---|---|
| PubChem CID | 56891558 |
| Molecular Formula | C20H30N4O2 |
| Molecular Weight | 358.49 g/mol |
| Exact Mass | 358.24 |
| IUPAC Name | (4aS,8aR)-1-[2-(methylamino)ethyl]-N-[(3-methylphenyl)methyl]-2-oxo-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridine-6-carboxamide |
| SMILES | CNCCN1C(=O)CC[C@H]2CN(C(=O)NCc3cccc(C)c3)CC[C@H]21 |
| InChI | InChI=1S/C20H30N4O2/c1-15-4-3-5-16(12-15)13-22-20(26)23-10-8-18-17(14-23)6-7-19(25)24(18)11-9-21-2/h3-5,12,17-18,21H,6-11,13-14H2,1-2H3,(H,22,26)/t17-,18+/m0/s1 |
| InChIKey | FHHROJOFJFHWID-ZWKOTPCHSA-N |
| XLogP | 1.74 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.49 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |