C18H28ClN5O2 — CID 154886885
(4aS,8aR)-6-(2,4-dimethylpyrimidine-5-carbonyl)-1-[2-(methylamino)ethyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one;hydrochloride (PubChem CID 154886885) has the molecular formula C18H28ClN5O2 and a molecular weight of 381.91 g/mol. Its IUPAC name is (4aS,8aR)-6-(2,4-dimethylpyrimidine-5-carbonyl)-1-[2-(methylamino)ethyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one;hydrochloride.
| Compound Name | (4aS,8aR)-6-(2,4-dimethylpyrimidine-5-carbonyl)-1-[2-(methylamino)ethyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one;hydrochloride |
|---|---|
| PubChem CID | 154886885 |
| Molecular Formula | C18H28ClN5O2 |
| Molecular Weight | 381.91 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | (4aS,8aR)-6-(2,4-dimethylpyrimidine-5-carbonyl)-1-[2-(methylamino)ethyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one;hydrochloride |
| SMILES | CNCCN1C(=O)CC[C@H]2CN(C(=O)c3cnc(C)nc3C)CC[C@H]21.Cl |
| InChI | InChI=1S/C18H27N5O2.ClH/c1-12-15(10-20-13(2)21-12)18(25)22-8-6-16-14(11-22)4-5-17(24)23(16)9-7-19-3;/h10,14,16,19H,4-9,11H2,1-3H3;1H/t14-,16+;/m0./s1 |
| InChIKey | VVSFJDCPYGZZMV-KUARMEPBSA-N |
| XLogP | 1.19 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.91 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |