C16H25N5O2S — CID 56907132
(4aS,8aR)-6-(4-ethylthiadiazole-5-carbonyl)-1-[2-(methylamino)ethyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one (PubChem CID 56907132) has the molecular formula C16H25N5O2S and a molecular weight of 351.48 g/mol. Its IUPAC name is (4aS,8aR)-6-(4-ethylthiadiazole-5-carbonyl)-1-[2-(methylamino)ethyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one.
| Compound Name | (4aS,8aR)-6-(4-ethylthiadiazole-5-carbonyl)-1-[2-(methylamino)ethyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
|---|---|
| PubChem CID | 56907132 |
| Molecular Formula | C16H25N5O2S |
| Molecular Weight | 351.48 g/mol |
| Exact Mass | 351.17 |
| IUPAC Name | (4aS,8aR)-6-(4-ethylthiadiazole-5-carbonyl)-1-[2-(methylamino)ethyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
| SMILES | CCc1nnsc1C(=O)N1CC[C@@H]2[C@@H](CCC(=O)N2CCNC)C1 |
| InChI | InChI=1S/C16H25N5O2S/c1-3-12-15(24-19-18-12)16(23)20-8-6-13-11(10-20)4-5-14(22)21(13)9-7-17-2/h11,13,17H,3-10H2,1-2H3/t11-,13+/m0/s1 |
| InChIKey | WHIHUFQKTBPJBO-WCQYABFASA-N |
| XLogP | 0.77 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.48 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |