C19H19N3O4 — CID 56892046
1-(2-methyl-1-benzofuran-7-carbonyl)-4-pyrazol-1-ylpiperidine-4-carboxylic acid (PubChem CID 56892046) has the molecular formula C19H19N3O4 and a molecular weight of 353.38 g/mol. Its IUPAC name is 1-(2-methyl-1-benzofuran-7-carbonyl)-4-pyrazol-1-ylpiperidine-4-carboxylic acid.
| Compound Name | 1-(2-methyl-1-benzofuran-7-carbonyl)-4-pyrazol-1-ylpiperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 56892046 |
| Molecular Formula | C19H19N3O4 |
| Molecular Weight | 353.38 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | 1-(2-methyl-1-benzofuran-7-carbonyl)-4-pyrazol-1-ylpiperidine-4-carboxylic acid |
| SMILES | Cc1cc2cccc(C(=O)N3CCC(C(=O)O)(n4cccn4)CC3)c2o1 |
| InChI | InChI=1S/C19H19N3O4/c1-13-12-14-4-2-5-15(16(14)26-13)17(23)21-10-6-19(7-11-21,18(24)25)22-9-3-8-20-22/h2-5,8-9,12H,6-7,10-11H2,1H3,(H,24,25) |
| InChIKey | TUDTXVVCXNWPHU-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 88.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.38 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |