C15H23N7 — CID 56894490
4-N-[3-(1-methylpyrazol-4-yl)propyl]-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepine-2,4-diamine (PubChem CID 56894490) has the molecular formula C15H23N7 and a molecular weight of 301.40 g/mol. Its IUPAC name is 4-N-[3-(1-methylpyrazol-4-yl)propyl]-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepine-2,4-diamine.
| Compound Name | 4-N-[3-(1-methylpyrazol-4-yl)propyl]-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepine-2,4-diamine |
|---|---|
| PubChem CID | 56894490 |
| Molecular Formula | C15H23N7 |
| Molecular Weight | 301.40 g/mol |
| Exact Mass | 301.20 |
| IUPAC Name | 4-N-[3-(1-methylpyrazol-4-yl)propyl]-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepine-2,4-diamine |
| SMILES | Cn1cc(CCCNc2nc(N)nc3c2CCNCC3)cn1 |
| InChI | InChI=1S/C15H23N7/c1-22-10-11(9-19-22)3-2-6-18-14-12-4-7-17-8-5-13(12)20-15(16)21-14/h9-10,17H,2-8H2,1H3,(H3,16,18,20,21) |
| InChIKey | CLOAHBKPZCCJGW-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 93.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.40 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|