C20H28N4O2 — CID 56895240
2-[(4aS,8aR)-1-(4-hydroxybutyl)-2-oxo-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-6-yl]-4,6-dimethylpyridine-3-carbonitrile (PubChem CID 56895240) has the molecular formula C20H28N4O2 and a molecular weight of 356.47 g/mol. Its IUPAC name is 2-[(4aS,8aR)-1-(4-hydroxybutyl)-2-oxo-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-6-yl]-4,6-dimethylpyridine-3-carbonitrile.
| Compound Name | 2-[(4aS,8aR)-1-(4-hydroxybutyl)-2-oxo-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-6-yl]-4,6-dimethylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 56895240 |
| Molecular Formula | C20H28N4O2 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.22 |
| IUPAC Name | 2-[(4aS,8aR)-1-(4-hydroxybutyl)-2-oxo-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-6-yl]-4,6-dimethylpyridine-3-carbonitrile |
| SMILES | Cc1cc(C)c(C#N)c(N2CC[C@@H]3[C@@H](CCC(=O)N3CCCCO)C2)n1 |
| InChI | InChI=1S/C20H28N4O2/c1-14-11-15(2)22-20(17(14)12-21)23-9-7-18-16(13-23)5-6-19(26)24(18)8-3-4-10-25/h11,16,18,25H,3-10,13H2,1-2H3/t16-,18+/m0/s1 |
| InChIKey | QAWLKEMIXVSPJF-FUHWJXTLSA-N |
| XLogP | 2.16 |
| TPSA | 80.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|