C21H29N3O2 — CID 56897376
(4aS,8aR)-1-(3-aminopropyl)-6-(2,3-dihydro-1H-indene-5-carbonyl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one (PubChem CID 56897376) has the molecular formula C21H29N3O2 and a molecular weight of 355.48 g/mol. Its IUPAC name is (4aS,8aR)-1-(3-aminopropyl)-6-(2,3-dihydro-1H-indene-5-carbonyl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one.
| Compound Name | (4aS,8aR)-1-(3-aminopropyl)-6-(2,3-dihydro-1H-indene-5-carbonyl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
|---|---|
| PubChem CID | 56897376 |
| Molecular Formula | C21H29N3O2 |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.23 |
| IUPAC Name | (4aS,8aR)-1-(3-aminopropyl)-6-(2,3-dihydro-1H-indene-5-carbonyl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
| SMILES | NCCCN1C(=O)CC[C@H]2CN(C(=O)c3ccc4c(c3)CCC4)CC[C@H]21 |
| InChI | InChI=1S/C21H29N3O2/c22-10-2-11-24-19-9-12-23(14-18(19)7-8-20(24)25)21(26)17-6-5-15-3-1-4-16(15)13-17/h5-6,13,18-19H,1-4,7-12,14,22H2/t18-,19+/m0/s1 |
| InChIKey | OFLLPWVWFUCSPI-RBUKOAKNSA-N |
| XLogP | 1.98 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |