C21H27N5O — CID 56898421
(4aS,8aS)-2-(2-pyridin-2-yl-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-4-yl)-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-ol (PubChem CID 56898421) has the molecular formula C21H27N5O and a molecular weight of 365.48 g/mol. Its IUPAC name is (4aS,8aS)-2-(2-pyridin-2-yl-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-4-yl)-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-ol.
| Compound Name | (4aS,8aS)-2-(2-pyridin-2-yl-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-4-yl)-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-ol |
|---|---|
| PubChem CID | 56898421 |
| Molecular Formula | C21H27N5O |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.22 |
| IUPAC Name | (4aS,8aS)-2-(2-pyridin-2-yl-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-4-yl)-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-ol |
| SMILES | O[C@]12CCCC[C@H]1CN(c1nc(-c3ccccn3)nc3c1CCNC3)CC2 |
| InChI | InChI=1S/C21H27N5O/c27-21-8-3-1-5-15(21)14-26(12-9-21)20-16-7-11-22-13-18(16)24-19(25-20)17-6-2-4-10-23-17/h2,4,6,10,15,22,27H,1,3,5,7-9,11-14H2/t15-,21-/m0/s1 |
| InChIKey | JPXHOZIWKUWMLF-BTYIYWSLSA-N |
| XLogP | 2.32 |
| TPSA | 74.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |